C24H31N3O3 — CID 71168436
1-[(7R)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3-[2-(2-piperidin-1-ylphenoxy)ethyl]urea (PubChem CID 71168436) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[(7R)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3-[2-(2-piperidin-1-ylphenoxy)ethyl]urea.
| Compound Name | 1-[(7R)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3-[2-(2-piperidin-1-ylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 71168436 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[(7R)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3-[2-(2-piperidin-1-ylphenoxy)ethyl]urea |
| SMILES | O=C(NCCOc1ccccc1N1CCCCC1)Nc1cccc2c1C[C@H](O)CC2 |
| InChI | InChI=1S/C24H31N3O3/c28-19-12-11-18-7-6-8-21(20(18)17-19)26-24(29)25-13-16-30-23-10-3-2-9-22(23)27-14-4-1-5-15-27/h2-3,6-10,19,28H,1,4-5,11-17H2,(H2,25,26,29)/t19-/m1/s1 |
| InChIKey | MQSZEPHRAZVYLC-LJQANCHMSA-N |
| XLogP | 3.73 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|