C13H12Cl2N4O3S — CID 59732122
ethyl 2-[[4,6-dichloro-5-(2-oxoethyl)pyrimidin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 59732122) has the molecular formula C13H12Cl2N4O3S and a molecular weight of 375.24 g/mol. Its IUPAC name is ethyl 2-[[4,6-dichloro-5-(2-oxoethyl)pyrimidin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[4,6-dichloro-5-(2-oxoethyl)pyrimidin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59732122 |
| Molecular Formula | C13H12Cl2N4O3S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | ethyl 2-[[4,6-dichloro-5-(2-oxoethyl)pyrimidin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc(Cl)c(CC=O)c(Cl)n2)nc1C |
| InChI | InChI=1S/C13H12Cl2N4O3S/c1-3-22-11(21)8-6(2)16-13(23-8)19-12-17-9(14)7(4-5-20)10(15)18-12/h5H,3-4H2,1-2H3,(H,16,17,18,19) |
| InChIKey | LUNBGAFSTXRTPP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|