C8H13NO2 — CID 59735391
(5R)-5-ethyl-3-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 59735391) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (5R)-5-ethyl-3-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-ethyl-3-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59735391 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (5R)-5-ethyl-3-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCN1C[C@@H](CC)OC1=O |
| InChI | InChI=1S/C8H13NO2/c1-3-5-9-6-7(4-2)11-8(9)10/h3,7H,1,4-6H2,2H3/t7-/m1/s1 |
| InChIKey | OMZTYGIVKQEFEB-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|