C25H18Cl3N3O3 — CID 59735837
3,5-bis[(2-chlorophenyl)methoxy]-N-(5-chloropyrazin-2-yl)benzamide (PubChem CID 59735837) has the molecular formula C25H18Cl3N3O3 and a molecular weight of 514.80 g/mol. Its IUPAC name is 3,5-bis[(2-chlorophenyl)methoxy]-N-(5-chloropyrazin-2-yl)benzamide.
| Compound Name | 3,5-bis[(2-chlorophenyl)methoxy]-N-(5-chloropyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 59735837 |
| Molecular Formula | C25H18Cl3N3O3 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 3,5-bis[(2-chlorophenyl)methoxy]-N-(5-chloropyrazin-2-yl)benzamide |
| SMILES | O=C(Nc1cnc(Cl)cn1)c1cc(OCc2ccccc2Cl)cc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H18Cl3N3O3/c26-21-7-3-1-5-16(21)14-33-19-9-18(25(32)31-24-13-29-23(28)12-30-24)10-20(11-19)34-15-17-6-2-4-8-22(17)27/h1-13H,14-15H2,(H,30,31,32) |
| InChIKey | IAJOEHDWMIFSOT-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |