C27H21ClN4O3 — CID 23124061
N-(5-amino-2-pyridinyl)-3-[(2-chlorophenyl)methoxy]-5-[(2-cyanophenyl)methoxy]benzamide (PubChem CID 23124061) has the molecular formula C27H21ClN4O3 and a molecular weight of 484.94 g/mol. Its IUPAC name is N-(5-amino-2-pyridinyl)-3-[(2-chlorophenyl)methoxy]-5-[(2-cyanophenyl)methoxy]benzamide.
| Compound Name | N-(5-amino-2-pyridinyl)-3-[(2-chlorophenyl)methoxy]-5-[(2-cyanophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 23124061 |
| Molecular Formula | C27H21ClN4O3 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | N-(5-amino-2-pyridinyl)-3-[(2-chlorophenyl)methoxy]-5-[(2-cyanophenyl)methoxy]benzamide |
| SMILES | N#Cc1ccccc1COc1cc(OCc2ccccc2Cl)cc(C(=O)Nc2ccc(N)cn2)c1 |
| InChI | InChI=1S/C27H21ClN4O3/c28-25-8-4-3-7-20(25)17-35-24-12-21(27(33)32-26-10-9-22(30)15-31-26)11-23(13-24)34-16-19-6-2-1-5-18(19)14-29/h1-13,15H,16-17,30H2,(H,31,32,33) |
| InChIKey | VJTXLIRGGFQWTN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |