C28H21Cl2NO5 — CID 23121812
(3-aminobenzoyl) 3,5-bis[(2-chlorophenyl)methoxy]benzoate (PubChem CID 23121812) has the molecular formula C28H21Cl2NO5 and a molecular weight of 522.38 g/mol. Its IUPAC name is (3-aminobenzoyl) 3,5-bis[(2-chlorophenyl)methoxy]benzoate.
| Compound Name | (3-aminobenzoyl) 3,5-bis[(2-chlorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 23121812 |
| Molecular Formula | C28H21Cl2NO5 |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | (3-aminobenzoyl) 3,5-bis[(2-chlorophenyl)methoxy]benzoate |
| SMILES | Nc1cccc(C(=O)OC(=O)c2cc(OCc3ccccc3Cl)cc(OCc3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C28H21Cl2NO5/c29-25-10-3-1-6-19(25)16-34-23-13-21(28(33)36-27(32)18-8-5-9-22(31)12-18)14-24(15-23)35-17-20-7-2-4-11-26(20)30/h1-15H,16-17,31H2 |
| InChIKey | NUQPGMFLGOKCSD-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|