C24H30NOP — CID 59736142
[(1R)-2-[(4R)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane (PubChem CID 59736142) has the molecular formula C24H30NOP and a molecular weight of 379.48 g/mol. Its IUPAC name is [(1R)-2-[(4R)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane.
| Compound Name | [(1R)-2-[(4R)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane |
|---|---|
| PubChem CID | 59736142 |
| Molecular Formula | C24H30NOP |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [(1R)-2-[(4R)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazol-2-yl]cyclopentyl]-diphenylphosphane |
| SMILES | CC(C)C[C@@H]1COC(C2CCC[C@H]2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H30NOP/c1-18(2)16-19-17-26-24(25-19)22-14-9-15-23(22)27(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,18-19,22-23H,9,14-17H2,1-2H3/t19-,22?,23-/m1/s1 |
| InChIKey | JSZRFPRBRDATHO-QQHBYLCDSA-N |
| XLogP | 5.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|