C16H24O7 — CID 59736404
6-[2-(2,2-dimethylbutanoylperoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 59736404) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 6-[2-(2,2-dimethylbutanoylperoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[2-(2,2-dimethylbutanoylperoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 59736404 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 6-[2-(2,2-dimethylbutanoylperoxy)ethoxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)OOCCOC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C16H24O7/c1-4-16(2,3)15(20)23-22-10-9-21-14(19)12-8-6-5-7-11(12)13(17)18/h5-6,11-12H,4,7-10H2,1-3H3,(H,17,18) |
| InChIKey | HIJKATWHPOGUEC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|