C9H17NOS — CID 59738209
3-methyl-4-pentyl-1,3-thiazolidin-2-one (PubChem CID 59738209) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 3-methyl-4-pentyl-1,3-thiazolidin-2-one.
| Compound Name | 3-methyl-4-pentyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 59738209 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 3-methyl-4-pentyl-1,3-thiazolidin-2-one |
| SMILES | CCCCCC1CSC(=O)N1C |
| InChI | InChI=1S/C9H17NOS/c1-3-4-5-6-8-7-12-9(11)10(8)2/h8H,3-7H2,1-2H3 |
| InChIKey | CZGVSPZZAPZDRO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|