About 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one
5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one (PubChem CID 167289002) has the molecular formula C11H21NOS
and a molecular weight of 215.36 g/mol. Its IUPAC name is 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one |
| PubChem CID | 167289002 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one |
| SMILES | CCCCCC1C(CC)SC(=O)N1C |
| InChI | InChI=1S/C11H21NOS/c1-4-6-7-8-9-10(5-2)14-11(13)12(9)3/h9-10H,4-8H2,1-3H3 |
| InChIKey | WZRQJCKQYKIPCT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one?
The IUPAC name of 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one (CID 167289002) is 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one.
What is the SMILES notation for 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one?
The canonical SMILES for 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one is CCCCCC1C(CC)SC(=O)N1C.
What is the InChIKey of 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one?
The InChIKey is WZRQJCKQYKIPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NOS/c1-4-6-7-8-9-10(5-2)14-11(13)12(9)3/h9-10H,4-8H2,1-3H3.
What are the key properties of 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one?
5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one has a molecular weight of 215.36 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-methyl-4-pentyl-1,3-thiazolidin-2-one is sourced from PubChem (CID 167289002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).