C12H23NO2 — CID 138501046
3-methyl-4-pentyl-5-propyl-1,3-oxazolidin-2-one (PubChem CID 138501046) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-methyl-4-pentyl-5-propyl-1,3-oxazolidin-2-one.
| Compound Name | 3-methyl-4-pentyl-5-propyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138501046 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3-methyl-4-pentyl-5-propyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCC1C(CCC)OC(=O)N1C |
| InChI | InChI=1S/C12H23NO2/c1-4-6-7-9-10-11(8-5-2)15-12(14)13(10)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | UEFJYYVULRESNX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|