C46H44N2O3 — CID 59745962
[3-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl] 8-oxononanoate (PubChem CID 59745962) has the molecular formula C46H44N2O3 and a molecular weight of 672.87 g/mol. Its IUPAC name is [3-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl] 8-oxononanoate.
| Compound Name | [3-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl] 8-oxononanoate |
|---|---|
| PubChem CID | 59745962 |
| Molecular Formula | C46H44N2O3 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | [3-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl] 8-oxononanoate |
| SMILES | CC(=O)CCCCCCC(=O)Oc1cccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cccc(C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C46H44N2O3/c1-35-15-13-21-43(33-35)47(39-17-8-5-9-18-39)41-29-25-37(26-30-41)38-27-31-42(32-28-38)48(40-19-10-6-11-20-40)44-22-14-23-45(34-44)51-46(50)24-12-4-3-7-16-36(2)49/h5-6,8-11,13-15,17-23,25-34H,3-4,7,12,16,24H2,1-2H3 |
| InChIKey | RKOXIIDRBAHXDN-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|