C38H38IrN2O4-2 — CID 59748581
[4-(3,5-dihydroxyhexyl)phenyl] 2-methylprop-2-enoate;iridium;bis(2-phenylpyridine) (PubChem CID 59748581) has the molecular formula C38H38IrN2O4-2 and a molecular weight of 778.95 g/mol. Its IUPAC name is [4-(3,5-dihydroxyhexyl)phenyl] 2-methylprop-2-enoate;iridium;bis(2-phenylpyridine).
| Compound Name | [4-(3,5-dihydroxyhexyl)phenyl] 2-methylprop-2-enoate;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 59748581 |
| Molecular Formula | C38H38IrN2O4-2 |
| Molecular Weight | 778.95 g/mol |
| Exact Mass | 779.25 |
| IUPAC Name | [4-(3,5-dihydroxyhexyl)phenyl] 2-methylprop-2-enoate;iridium;bis(2-phenylpyridine) |
| SMILES | C=C(C)C(=O)Oc1ccc(CCC(O)CC(C)O)cc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C16H22O4.2C11H8N.Ir/c1-11(2)16(19)20-15-8-5-13(6-9-15)4-7-14(18)10-12(3)17;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-6,8-9,12,14,17-18H,1,4,7,10H2,2-3H3;2*1-6,8-9H;/q;2*-1; |
| InChIKey | RPUVRPFFCXPIBF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.95 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|