C22H33ClO3S — CID 59748883
[(3S,7S,10R,13S,16R)-16-chloro-7-methoxy-10,13-dimethyl-3-sulfanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 59748883) has the molecular formula C22H33ClO3S and a molecular weight of 413.02 g/mol. Its IUPAC name is [(3S,7S,10R,13S,16R)-16-chloro-7-methoxy-10,13-dimethyl-3-sulfanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3S,7S,10R,13S,16R)-16-chloro-7-methoxy-10,13-dimethyl-3-sulfanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 59748883 |
| Molecular Formula | C22H33ClO3S |
| Molecular Weight | 413.02 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | [(3S,7S,10R,13S,16R)-16-chloro-7-methoxy-10,13-dimethyl-3-sulfanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COC1CC2=C[C@@H](S)CC[C@]2(C)C2CC[C@@]3(C)C(C[C@@H](Cl)C3OC(C)=O)C12 |
| InChI | InChI=1S/C22H33ClO3S/c1-12(24)26-20-17(23)11-16-19-15(6-8-22(16,20)3)21(2)7-5-14(27)9-13(21)10-18(19)25-4/h9,14-20,27H,5-8,10-11H2,1-4H3/t14-,15?,16?,17+,18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | ZJTROVCRQQDAPP-LBEAMAASSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.02 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|