C16H21NO6 — CID 59749994
ethyl 2-[(2S,6R)-4,4-dimethyl-9,11-dioxo-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecan-10-yl]acetate (PubChem CID 59749994) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is ethyl 2-[(2S,6R)-4,4-dimethyl-9,11-dioxo-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecan-10-yl]acetate.
| Compound Name | ethyl 2-[(2S,6R)-4,4-dimethyl-9,11-dioxo-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecan-10-yl]acetate |
|---|---|
| PubChem CID | 59749994 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | ethyl 2-[(2S,6R)-4,4-dimethyl-9,11-dioxo-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecan-10-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C(C1=O)C1CC2[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H21NO6/c1-4-21-9(18)6-17-14(19)10-7-5-8(11(10)15(17)20)13-12(7)22-16(2,3)23-13/h7-8,10-13H,4-6H2,1-3H3/t7?,8?,10?,11?,12-,13+ |
| InChIKey | SOOIAUIDVVLMKN-MQBCROKASA-N |
| XLogP | 0.32 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|