C14H17NO6 — CID 124858890
[(1R,2R,6R,7S,8R,9S)-9-acetyloxy-4-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate (PubChem CID 124858890) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is [(1R,2R,6R,7S,8R,9S)-9-acetyloxy-4-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate.
| Compound Name | [(1R,2R,6R,7S,8R,9S)-9-acetyloxy-4-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate |
|---|---|
| PubChem CID | 124858890 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [(1R,2R,6R,7S,8R,9S)-9-acetyloxy-4-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2C[C@@H]([C@@H]1OC(C)=O)[C@H]1C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C14H17NO6/c1-5(16)20-11-7-4-8(12(11)21-6(2)17)10-9(7)13(18)15(3)14(10)19/h7-12H,4H2,1-3H3/t7-,8+,9-,10-,11+,12-/m1/s1 |
| InChIKey | SJPJWFVUEGVUKN-IXXAWXHISA-N |
| XLogP | -0.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|