C13H17NO5Y-2 — CID 146739791
carbanide;(9-methoxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium (PubChem CID 146739791) has the molecular formula C13H17NO5Y-2 and a molecular weight of 356.19 g/mol. Its IUPAC name is carbanide;(9-methoxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium.
| Compound Name | carbanide;(9-methoxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium |
|---|---|
| PubChem CID | 146739791 |
| Molecular Formula | C13H17NO5Y-2 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | carbanide;(9-methoxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium |
| SMILES | COC1C2CC(C1OC(C)=O)C1C(=O)[N-]C(=O)C21.[CH3-].[Y] |
| InChI | InChI=1S/C12H15NO5.CH3.Y/c1-4(14)18-10-6-3-5(9(10)17-2)7-8(6)12(16)13-11(7)15;;/h5-10H,3H2,1-2H3,(H,13,15,16);1H3;/q;-1;/p-1 |
| InChIKey | LDMWEBOCSJJAIY-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|