C11H15NO4Y-2 — CID 158984479
carbanide;8-hydroxy-9-methoxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium (PubChem CID 158984479) has the molecular formula C11H15NO4Y-2 and a molecular weight of 314.15 g/mol. Its IUPAC name is carbanide;8-hydroxy-9-methoxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium.
| Compound Name | carbanide;8-hydroxy-9-methoxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium |
|---|---|
| PubChem CID | 158984479 |
| Molecular Formula | C11H15NO4Y-2 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | carbanide;8-hydroxy-9-methoxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium |
| SMILES | COC1C(O)C2CC1C1C(=O)[N-]C(=O)C21.[CH3-].[Y] |
| InChI | InChI=1S/C10H13NO4.CH3.Y/c1-15-8-4-2-3(7(8)12)5-6(4)10(14)11-9(5)13;;/h3-8,12H,2H2,1H3,(H,11,13,14);1H3;/q;-1;/p-1 |
| InChIKey | AXPJBDISBYUBHH-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 77.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|