C12H18S3 — CID 59755463
3-octyl-4-sulfanylcyclobut-3-ene-1,2-dithione (PubChem CID 59755463) has the molecular formula C12H18S3 and a molecular weight of 258.48 g/mol. Its IUPAC name is 3-octyl-4-sulfanylcyclobut-3-ene-1,2-dithione.
| Compound Name | 3-octyl-4-sulfanylcyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 59755463 |
| Molecular Formula | C12H18S3 |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-octyl-4-sulfanylcyclobut-3-ene-1,2-dithione |
| SMILES | CCCCCCCCc1c(S)c(=S)c1=S |
| InChI | InChI=1S/C12H18S3/c1-2-3-4-5-6-7-8-9-10(13)12(15)11(9)14/h13H,2-8H2,1H3 |
| InChIKey | WSLWIZHNZUUPIL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|