C9H10S4 — CID 59755493
4-butyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione (PubChem CID 59755493) has the molecular formula C9H10S4 and a molecular weight of 246.45 g/mol. Its IUPAC name is 4-butyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione.
| Compound Name | 4-butyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione |
|---|---|
| PubChem CID | 59755493 |
| Molecular Formula | C9H10S4 |
| Molecular Weight | 246.45 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 4-butyl-5-sulfanylcyclopent-4-ene-1,2,3-trithione |
| SMILES | CCCCc1c(S)c(=S)c(=S)c1=S |
| InChI | InChI=1S/C9H10S4/c1-2-3-4-5-6(10)8(12)9(13)7(5)11/h10H,2-4H2,1H3 |
| InChIKey | JIZIXBCNOHPDHD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|