C23H27N3O3 — CID 59755832
(9R,10R)-10-[4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 59755832) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (9R,10R)-10-[4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-10-[4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 59755832 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (9R,10R)-10-[4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ylamino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | CC(CCc1ccc2c(c1)CCO2)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C23H27N3O3/c1-14(5-6-15-7-8-20-16(13-15)10-12-29-20)24-19-9-11-26-21-17(22(19)27)3-2-4-18(21)25-23(26)28/h2-4,7-8,13-14,19,22,24,27H,5-6,9-12H2,1H3,(H,25,28)/t14?,19-,22-/m1/s1 |
| InChIKey | GDCWYNQWEYNUOX-HLXLLJQLSA-N |
| XLogP | 2.68 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |