C20H39NO5 — CID 59762533
N-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl]decanamide (PubChem CID 59762533) has the molecular formula C20H39NO5 and a molecular weight of 373.53 g/mol. Its IUPAC name is N-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl]decanamide.
| Compound Name | N-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl]decanamide |
|---|---|
| PubChem CID | 59762533 |
| Molecular Formula | C20H39NO5 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | N-[[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]methyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC1OC(C(C)(C)C)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H39NO5/c1-5-6-7-8-9-10-11-12-15(22)21-13-14-16(23)17(24)18(25)19(26-14)20(2,3)4/h14,16-19,23-25H,5-13H2,1-4H3,(H,21,22)/t14?,16-,17-,18?,19?/m0/s1 |
| InChIKey | USLLELCUUZJQLZ-BDLXZXNFSA-N |
| XLogP | 2.14 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|