C22H22FN3O4S — CID 59763902
[3-[2-amino-4-[3-(cyclopenten-1-yl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate (PubChem CID 59763902) has the molecular formula C22H22FN3O4S and a molecular weight of 443.50 g/mol. Its IUPAC name is [3-[2-amino-4-[3-(cyclopenten-1-yl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate.
| Compound Name | [3-[2-amino-4-[3-(cyclopenten-1-yl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 59763902 |
| Molecular Formula | C22H22FN3O4S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [3-[2-amino-4-[3-(cyclopenten-1-yl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
| SMILES | CN1C(=O)C(c2cccc(OS(C)(=O)=O)c2)(c2ccc(F)c(C3=CCCC3)c2)N=C1N |
| InChI | InChI=1S/C22H22FN3O4S/c1-26-20(27)22(25-21(26)24,15-8-5-9-17(12-15)30-31(2,28)29)16-10-11-19(23)18(13-16)14-6-3-4-7-14/h5-6,8-13H,3-4,7H2,1-2H3,(H2,24,25) |
| InChIKey | ZDLAPVSVBWVKJG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|