C22H17ClF2N4O4S — CID 24991735
[3-[2-amino-4-[3-(5-chloro-2-fluoro-3-pyridinyl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate (PubChem CID 24991735) has the molecular formula C22H17ClF2N4O4S and a molecular weight of 506.92 g/mol. Its IUPAC name is [3-[2-amino-4-[3-(5-chloro-2-fluoro-3-pyridinyl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate.
| Compound Name | [3-[2-amino-4-[3-(5-chloro-2-fluoro-3-pyridinyl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 24991735 |
| Molecular Formula | C22H17ClF2N4O4S |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | [3-[2-amino-4-[3-(5-chloro-2-fluoro-3-pyridinyl)-4-fluorophenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
| SMILES | CN1C(=O)C(c2cccc(OS(C)(=O)=O)c2)(c2ccc(F)c(-c3cc(Cl)cnc3F)c2)N=C1N |
| InChI | InChI=1S/C22H17ClF2N4O4S/c1-29-20(30)22(28-21(29)26,12-4-3-5-15(8-12)33-34(2,31)32)13-6-7-18(24)16(9-13)17-10-14(23)11-27-19(17)25/h3-11H,1-2H3,(H2,26,28) |
| InChIKey | YZNMXLSMEUFRDT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|