C23H28N2O4S2 — CID 59764133
ethyl (5S)-5-(tert-butylsulfinylamino)-5-[4-(3-isocyanophenyl)thiophen-2-yl]-3-oxohexanoate (PubChem CID 59764133) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is ethyl (5S)-5-(tert-butylsulfinylamino)-5-[4-(3-isocyanophenyl)thiophen-2-yl]-3-oxohexanoate.
| Compound Name | ethyl (5S)-5-(tert-butylsulfinylamino)-5-[4-(3-isocyanophenyl)thiophen-2-yl]-3-oxohexanoate |
|---|---|
| PubChem CID | 59764133 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | ethyl (5S)-5-(tert-butylsulfinylamino)-5-[4-(3-isocyanophenyl)thiophen-2-yl]-3-oxohexanoate |
| SMILES | [C-]#[N+]c1cccc(-c2csc([C@](C)(CC(=O)CC(=O)OCC)NS(=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C23H28N2O4S2/c1-7-29-21(27)13-19(26)14-23(5,25-31(28)22(2,3)4)20-12-17(15-30-20)16-9-8-10-18(11-16)24-6/h8-12,15,25H,7,13-14H2,1-5H3/t23-,31?/m0/s1 |
| InChIKey | NLHLXESWWORIPX-YNBNEFOKSA-N |
| XLogP | 5.15 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|