C19H22N2O3S2 — CID 59764137
(3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoic acid (PubChem CID 59764137) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoic acid.
| Compound Name | (3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 59764137 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoic acid |
| SMILES | [C-]#[N+]c1cccc(-c2csc([C@](C)(CC(=O)O)NS(=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-18(2,3)26(24)21-19(4,11-17(22)23)16-10-14(12-25-16)13-7-6-8-15(9-13)20-5/h6-10,12,21H,11H2,1-4H3,(H,22,23)/t19-,26?/m0/s1 |
| InChIKey | DABFXHZIBDMORQ-SXMXNQBWSA-N |
| XLogP | 4.71 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|