C20H24N2O3S2 — CID 59764157
methyl (3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoate (PubChem CID 59764157) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is methyl (3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoate.
| Compound Name | methyl (3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoate |
|---|---|
| PubChem CID | 59764157 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | methyl (3S)-3-(tert-butylsulfinylamino)-3-[4-(3-isocyanophenyl)thiophen-2-yl]butanoate |
| SMILES | [C-]#[N+]c1cccc(-c2csc([C@](C)(CC(=O)OC)NS(=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C20H24N2O3S2/c1-19(2,3)27(24)22-20(4,12-18(23)25-6)17-11-15(13-26-17)14-8-7-9-16(10-14)21-5/h7-11,13,22H,12H2,1-4,6H3/t20-,27?/m0/s1 |
| InChIKey | NAFZLKOYYZTGLI-SVQMELKDSA-N |
| XLogP | 4.80 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|