C19H25NO2S — CID 143109005
ethyl 3-[5-(2-aminophenyl)thiophen-2-yl]-2,2,3-trimethylbutanoate (PubChem CID 143109005) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is ethyl 3-[5-(2-aminophenyl)thiophen-2-yl]-2,2,3-trimethylbutanoate.
| Compound Name | ethyl 3-[5-(2-aminophenyl)thiophen-2-yl]-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 143109005 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | ethyl 3-[5-(2-aminophenyl)thiophen-2-yl]-2,2,3-trimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(C)(C)c1ccc(-c2ccccc2N)s1 |
| InChI | InChI=1S/C19H25NO2S/c1-6-22-17(21)19(4,5)18(2,3)16-12-11-15(23-16)13-9-7-8-10-14(13)20/h7-12H,6,20H2,1-5H3 |
| InChIKey | UJRBFPTTWOTLMG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|