C22H31NO4S2Si — CID 91397514
2-trimethylsilylethyl 2-[(2S)-2-[5-(3-aminophenyl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetate (PubChem CID 91397514) has the molecular formula C22H31NO4S2Si and a molecular weight of 465.71 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2S)-2-[5-(3-aminophenyl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-(3-aminophenyl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
|---|---|
| PubChem CID | 91397514 |
| Molecular Formula | C22H31NO4S2Si |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-(3-aminophenyl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
| SMILES | C[Si](C)(C)CCOC(=O)C[C@]1(c2ccc(-c3cccc(N)c3)s2)CCCCS1(=O)=O |
| InChI | InChI=1S/C22H31NO4S2Si/c1-30(2,3)14-12-27-21(24)16-22(11-4-5-13-29(22,25)26)20-10-9-19(28-20)17-7-6-8-18(23)15-17/h6-10,15H,4-5,11-14,16,23H2,1-3H3/t22-/m0/s1 |
| InChIKey | DJANKQNLXCZSQY-QFIPXVFZSA-N |
| XLogP | 5.06 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|