C29H37NO6S3Si — CID 86595672
2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(methanesulfonamido)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate (PubChem CID 86595672) has the molecular formula C29H37NO6S3Si and a molecular weight of 619.90 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(methanesulfonamido)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(methanesulfonamido)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
|---|---|
| PubChem CID | 86595672 |
| Molecular Formula | C29H37NO6S3Si |
| Molecular Weight | 619.90 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2S)-2-[5-[4-[4-(methanesulfonamido)phenyl]phenyl]thiophen-2-yl]-1,1-dioxothian-2-yl]acetate |
| SMILES | C[Si](C)(C)CCOC(=O)C[C@]1(c2ccc(-c3ccc(-c4ccc(NS(C)(=O)=O)cc4)cc3)s2)CCCCS1(=O)=O |
| InChI | InChI=1S/C29H37NO6S3Si/c1-38(32,33)30-25-13-11-23(12-14-25)22-7-9-24(10-8-22)26-15-16-27(37-26)29(17-5-6-19-39(29,34)35)21-28(31)36-18-20-40(2,3)4/h7-16,30H,5-6,17-21H2,1-4H3/t29-/m0/s1 |
| InChIKey | WZDOQYYPROJXPC-LJAQVGFWSA-N |
| XLogP | 6.52 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.90 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|