C21H29N3O7 — CID 59764484
tert-butyl 4-(1-hydroxy-5-nitro-3-oxo-6-propan-2-yloxy-1H-isoindol-2-yl)piperidine-1-carboxylate (PubChem CID 59764484) has the molecular formula C21H29N3O7 and a molecular weight of 435.48 g/mol. Its IUPAC name is tert-butyl 4-(1-hydroxy-5-nitro-3-oxo-6-propan-2-yloxy-1H-isoindol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-hydroxy-5-nitro-3-oxo-6-propan-2-yloxy-1H-isoindol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59764484 |
| Molecular Formula | C21H29N3O7 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl 4-(1-hydroxy-5-nitro-3-oxo-6-propan-2-yloxy-1H-isoindol-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)Oc1cc2c(cc1[N+](=O)[O-])C(=O)N(C1CCN(C(=O)OC(C)(C)C)CC1)C2O |
| InChI | InChI=1S/C21H29N3O7/c1-12(2)30-17-11-15-14(10-16(17)24(28)29)18(25)23(19(15)26)13-6-8-22(9-7-13)20(27)31-21(3,4)5/h10-13,19,26H,6-9H2,1-5H3 |
| InChIKey | CNJXQQFPHZUSJR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|