C18H33N3O5 — CID 59766528
N-[5-(2-methylbutoxy)pentyl]-N'-[[(E)-2-oxopropylideneamino]oxymethyl]butanediamide (PubChem CID 59766528) has the molecular formula C18H33N3O5 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[5-(2-methylbutoxy)pentyl]-N'-[[(E)-2-oxopropylideneamino]oxymethyl]butanediamide.
| Compound Name | N-[5-(2-methylbutoxy)pentyl]-N'-[[(E)-2-oxopropylideneamino]oxymethyl]butanediamide |
|---|---|
| PubChem CID | 59766528 |
| Molecular Formula | C18H33N3O5 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | N-[5-(2-methylbutoxy)pentyl]-N'-[[(E)-2-oxopropylideneamino]oxymethyl]butanediamide |
| SMILES | CCC(C)COCCCCCNC(=O)CCC(=O)NCO/N=C/C(C)=O |
| InChI | InChI=1S/C18H33N3O5/c1-4-15(2)13-25-11-7-5-6-10-19-17(23)8-9-18(24)20-14-26-21-12-16(3)22/h12,15H,4-11,13-14H2,1-3H3,(H,19,23)(H,20,24)/b21-12+ |
| InChIKey | LVWVDPKMZKGCPH-CIAFOILYSA-N |
| XLogP | 1.78 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|