C18H14N2O4S — CID 59767724
2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 59767724) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 59767724 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C18H14N2O4S/c21-17(22)15-10-11-25-16(15)20-18(23)19-12-6-8-14(9-7-12)24-13-4-2-1-3-5-13/h1-11H,(H,21,22)(H2,19,20,23) |
| InChIKey | DKHYBPGCJYZFHK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |