C22H22N2O4S — CID 86626597
tert-butyl 2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylate (PubChem CID 86626597) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is tert-butyl 2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 86626597 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | tert-butyl 2-[(4-phenoxyphenyl)carbamoylamino]thiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccsc1NC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-22(2,3)28-20(25)18-13-14-29-19(18)24-21(26)23-15-9-11-17(12-10-15)27-16-7-5-4-6-8-16/h4-14H,1-3H3,(H2,23,24,26) |
| InChIKey | LWQKAYUUJINDGV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |