C23H20N4O — CID 59768233
N,N-dibenzyl-2-pyridin-3-yl-1H-imidazole-5-carboxamide (PubChem CID 59768233) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is N,N-dibenzyl-2-pyridin-3-yl-1H-imidazole-5-carboxamide.
| Compound Name | N,N-dibenzyl-2-pyridin-3-yl-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 59768233 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N,N-dibenzyl-2-pyridin-3-yl-1H-imidazole-5-carboxamide |
| SMILES | O=C(c1cnc(-c2cccnc2)[nH]1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H20N4O/c28-23(21-15-25-22(26-21)20-12-7-13-24-14-20)27(16-18-8-3-1-4-9-18)17-19-10-5-2-6-11-19/h1-15H,16-17H2,(H,25,26) |
| InChIKey | JMVVNALRUCKQGX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |