C22H27N3O — CID 59771315
(1R,2S)-1-indol-1-yl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-2-ol (PubChem CID 59771315) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is (1R,2S)-1-indol-1-yl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-2-ol.
| Compound Name | (1R,2S)-1-indol-1-yl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 59771315 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (1R,2S)-1-indol-1-yl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-2-ol |
| SMILES | CN1CCN(C[C@H](O)[C@@H](c2ccccc2)n2ccc3ccccc32)CC1 |
| InChI | InChI=1S/C22H27N3O/c1-23-13-15-24(16-14-23)17-21(26)22(19-8-3-2-4-9-19)25-12-11-18-7-5-6-10-20(18)25/h2-12,21-22,26H,13-17H2,1H3/t21-,22+/m0/s1 |
| InChIKey | WNNACCODSWYYDZ-FCHUYYIVSA-N |
| XLogP | 2.84 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |