C23H23NO6S — CID 59771404
N-phenyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxynaphthalene-2-carboxamide (PubChem CID 59771404) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-phenyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxynaphthalene-2-carboxamide.
| Compound Name | N-phenyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 59771404 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-phenyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxynaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc2ccccc2cc1O[C@@H]1S[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H23NO6S/c25-12-18-19(26)20(27)21(28)23(31-18)30-17-11-14-7-5-4-6-13(14)10-16(17)22(29)24-15-8-2-1-3-9-15/h1-11,18-21,23,25-28H,12H2,(H,24,29)/t18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | IPPAKDYODIFVBM-ZFVIQDPVSA-N |
| XLogP | 1.99 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |