C21H26ClN3O3 — CID 59778593
1-[(2-chlorophenyl)methylcarbamoyl-methylamino]propan-2-yl N-(4-ethylphenyl)carbamate (PubChem CID 59778593) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylcarbamoyl-methylamino]propan-2-yl N-(4-ethylphenyl)carbamate.
| Compound Name | 1-[(2-chlorophenyl)methylcarbamoyl-methylamino]propan-2-yl N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 59778593 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[(2-chlorophenyl)methylcarbamoyl-methylamino]propan-2-yl N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)OC(C)CN(C)C(=O)NCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-4-16-9-11-18(12-10-16)24-21(27)28-15(2)14-25(3)20(26)23-13-17-7-5-6-8-19(17)22/h5-12,15H,4,13-14H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | ZLCABYIHCICIOR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |