C21H27ClN4O3 — CID 91802738
[3-amino-1-[2-aminoethyl-[(2-chlorophenyl)methyl]amino]-3-oxopropyl] N-(4-ethylphenyl)carbamate (PubChem CID 91802738) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is [3-amino-1-[2-aminoethyl-[(2-chlorophenyl)methyl]amino]-3-oxopropyl] N-(4-ethylphenyl)carbamate.
| Compound Name | [3-amino-1-[2-aminoethyl-[(2-chlorophenyl)methyl]amino]-3-oxopropyl] N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 91802738 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [3-amino-1-[2-aminoethyl-[(2-chlorophenyl)methyl]amino]-3-oxopropyl] N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)OC(CC(N)=O)N(CCN)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H27ClN4O3/c1-2-15-7-9-17(10-8-15)25-21(28)29-20(13-19(24)27)26(12-11-23)14-16-5-3-4-6-18(16)22/h3-10,20H,2,11-14,23H2,1H3,(H2,24,27)(H,25,28) |
| InChIKey | LAHOEQCQIUDWKS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|