C22H22ClN3O3 — CID 91806238
[4-amino-1-[(2-chlorophenyl)methylamino]-4-oxobutan-2-yl] N-naphthalen-2-ylcarbamate (PubChem CID 91806238) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is [4-amino-1-[(2-chlorophenyl)methylamino]-4-oxobutan-2-yl] N-naphthalen-2-ylcarbamate.
| Compound Name | [4-amino-1-[(2-chlorophenyl)methylamino]-4-oxobutan-2-yl] N-naphthalen-2-ylcarbamate |
|---|---|
| PubChem CID | 91806238 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [4-amino-1-[(2-chlorophenyl)methylamino]-4-oxobutan-2-yl] N-naphthalen-2-ylcarbamate |
| SMILES | NC(=O)CC(CNCc1ccccc1Cl)OC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-20-8-4-3-7-17(20)13-25-14-19(12-21(24)27)29-22(28)26-18-10-9-15-5-1-2-6-16(15)11-18/h1-11,19,25H,12-14H2,(H2,24,27)(H,26,28) |
| InChIKey | ZRAVCKVZCUMVAX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |