C22H27ClN4O3 — CID 87761367
[(2S,4R)-4-amino-1-[(2-chlorophenyl)methyl-formylamino]pyrrolidin-2-yl]methyl N-(4-ethylphenyl)carbamate (PubChem CID 87761367) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is [(2S,4R)-4-amino-1-[(2-chlorophenyl)methyl-formylamino]pyrrolidin-2-yl]methyl N-(4-ethylphenyl)carbamate.
| Compound Name | [(2S,4R)-4-amino-1-[(2-chlorophenyl)methyl-formylamino]pyrrolidin-2-yl]methyl N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 87761367 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [(2S,4R)-4-amino-1-[(2-chlorophenyl)methyl-formylamino]pyrrolidin-2-yl]methyl N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)OC[C@@H]2C[C@@H](N)CN2N(C=O)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClN4O3/c1-2-16-7-9-19(10-8-16)25-22(29)30-14-20-11-18(24)13-27(20)26(15-28)12-17-5-3-4-6-21(17)23/h3-10,15,18,20H,2,11-14,24H2,1H3,(H,25,29)/t18-,20+/m1/s1 |
| InChIKey | GXTSYZDUPVOENK-QUCCMNQESA-N |
| XLogP | 3.43 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|