C20H24ClN3O3 — CID 59778513
2-[(2-chlorophenyl)methylcarbamoyl-methylamino]ethyl N-(4-ethylphenyl)carbamate (PubChem CID 59778513) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylcarbamoyl-methylamino]ethyl N-(4-ethylphenyl)carbamate.
| Compound Name | 2-[(2-chlorophenyl)methylcarbamoyl-methylamino]ethyl N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 59778513 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-[(2-chlorophenyl)methylcarbamoyl-methylamino]ethyl N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)OCCN(C)C(=O)NCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O3/c1-3-15-8-10-17(11-9-15)23-20(26)27-13-12-24(2)19(25)22-14-16-6-4-5-7-18(16)21/h4-11H,3,12-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | NGUPKAWQZFMCJY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |