About (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine
(Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine (PubChem CID 59782336) has the molecular formula C17H15F3IrNO2-
and a molecular weight of 514.52 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
Molecular Properties
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| PubChem CID | 59782336 |
| Molecular Formula | C17H15F3IrNO2- |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| SMILES | CC(=O)/C=C(/C)O.FC(F)(F)c1c[c-]c(-c2ccccn2)cc1.[Ir] |
| InChI | InChI=1S/C12H7F3N.C5H8O2.Ir/c13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11;1-4(6)3-5(2)7;/h1-4,6-8H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | YYXBXUZZGGKKIG-LWFKIUJUSA-N |
| XLogP | 4.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The IUPAC name of (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine (CID 59782336) is (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
What is the SMILES notation for (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The canonical SMILES for (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine is CC(=O)/C=C(/C)O.FC(F)(F)c1c[c-]c(-c2ccccn2)cc1.[Ir].
What is the InChIKey of (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
The InChIKey is YYXBXUZZGGKKIG-LWFKIUJUSA-N. The full InChI is InChI=1S/C12H7F3N.C5H8O2.Ir/c13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11;1-4(6)3-5(2)7;/h1-4,6-8H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine?
(Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine has a molecular weight of 514.52 g/mol, XLogP of 4.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxypent-3-en-2-one;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine is sourced from PubChem (CID 59782336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).