C14H25N3O7PS+ — CID 59783299
[(5R)-5-(6-oxo-4-sulfanylidene-1H-1,3,5-triazin-3-ium-3-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl] propan-2-yl hydrogen phosphate (PubChem CID 59783299) has the molecular formula C14H25N3O7PS+ and a molecular weight of 410.41 g/mol. Its IUPAC name is [(5R)-5-(6-oxo-4-sulfanylidene-1H-1,3,5-triazin-3-ium-3-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl] propan-2-yl hydrogen phosphate.
| Compound Name | [(5R)-5-(6-oxo-4-sulfanylidene-1H-1,3,5-triazin-3-ium-3-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl] propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 59783299 |
| Molecular Formula | C14H25N3O7PS+ |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(5R)-5-(6-oxo-4-sulfanylidene-1H-1,3,5-triazin-3-ium-3-yl)-2-(propan-2-yloxymethyl)oxolan-3-yl] propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OCC1O[C@@H]([n+]2c[nH]c(=O)[nH]c2=S)CC1OP(=O)(O)OC(C)C |
| InChI | InChI=1S/C14H24N3O7PS/c1-8(2)21-6-11-10(24-25(19,20)23-9(3)4)5-12(22-11)17-7-15-13(18)16-14(17)26/h7-12H,5-6H2,1-4H3,(H2,16,18,19,20,26)/p+1/t10?,11?,12-/m1/s1 |
| InChIKey | LZQNWDGNWGAHQB-HTAVTVPLSA-O |
| XLogP | 1.34 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|