C21H20N4O2 — CID 59783464
N-hydroxy-2-[methyl(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)amino]pyrimidine-5-carboxamide (PubChem CID 59783464) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-hydroxy-2-[methyl(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[methyl(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59783464 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-hydroxy-2-[methyl(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)amino]pyrimidine-5-carboxamide |
| SMILES | CN(c1ncc(C(=O)NO)cn1)C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C21H20N4O2/c1-25(21-22-12-16(13-23-21)20(26)24-27)19-17-8-4-2-6-14(17)10-11-15-7-3-5-9-18(15)19/h2-9,12-13,19,27H,10-11H2,1H3,(H,24,26) |
| InChIKey | MXYMRBLFKXNNMZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|