About methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane
methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane (PubChem CID 59787460) has the molecular formula C18H18N2OSSi
and a molecular weight of 338.51 g/mol. Its IUPAC name is methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane.
Molecular Properties
| Compound Name | methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane |
| PubChem CID | 59787460 |
| Molecular Formula | C18H18N2OSSi |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane |
| SMILES | Cc1ccc2sc([Si](C)(c3coc(C)c3)n3cccc3)nc2c1 |
| InChI | InChI=1S/C18H18N2OSSi/c1-13-6-7-17-16(10-13)19-18(22-17)23(3,20-8-4-5-9-20)15-11-14(2)21-12-15/h4-12H,1-3H3 |
| InChIKey | CVIDKSAWYBVVSN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane?
The IUPAC name of methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane (CID 59787460) is methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane.
What is the SMILES notation for methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane?
The canonical SMILES for methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane is Cc1ccc2sc([Si](C)(c3coc(C)c3)n3cccc3)nc2c1.
What is the InChIKey of methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane?
The InChIKey is CVIDKSAWYBVVSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2OSSi/c1-13-6-7-17-16(10-13)19-18(22-17)23(3,20-8-4-5-9-20)15-11-14(2)21-12-15/h4-12H,1-3H3.
What are the key properties of methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane?
methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane has a molecular weight of 338.51 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(5-methyl-1,3-benzothiazol-2-yl)-(5-methylfuran-3-yl)-pyrrol-1-ylsilane is sourced from PubChem (CID 59787460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).