C16H13F7O2S — CID 59787724
[3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate (PubChem CID 59787724) has the molecular formula C16H13F7O2S and a molecular weight of 402.33 g/mol. Its IUPAC name is [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate.
| Compound Name | [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 59787724 |
| Molecular Formula | C16H13F7O2S |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)Oc2cc(F)c(S(F)(F)(F)(F)F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C16H13F7O2S/c1-8-4-9(2)14(10(3)5-8)16(24)25-11-6-12(17)15(13(18)7-11)26(19,20,21,22)23/h4-7H,1-3H3 |
| InChIKey | RJJBCFKNWXRMAS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|