C19H18BrN5O3 — CID 59788242
4-[[2-amino-6-[5-bromo-2-(methoxymethyl)phenyl]pyrimidin-4-yl]amino]-N-hydroxybenzamide (PubChem CID 59788242) has the molecular formula C19H18BrN5O3 and a molecular weight of 444.29 g/mol. Its IUPAC name is 4-[[2-amino-6-[5-bromo-2-(methoxymethyl)phenyl]pyrimidin-4-yl]amino]-N-hydroxybenzamide.
| Compound Name | 4-[[2-amino-6-[5-bromo-2-(methoxymethyl)phenyl]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 59788242 |
| Molecular Formula | C19H18BrN5O3 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 4-[[2-amino-6-[5-bromo-2-(methoxymethyl)phenyl]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
| SMILES | COCc1ccc(Br)cc1-c1cc(Nc2ccc(C(=O)NO)cc2)nc(N)n1 |
| InChI | InChI=1S/C19H18BrN5O3/c1-28-10-12-2-5-13(20)8-15(12)16-9-17(24-19(21)23-16)22-14-6-3-11(4-7-14)18(26)25-27/h2-9,27H,10H2,1H3,(H,25,26)(H3,21,22,23,24) |
| InChIKey | BFKVMXRARZQCFR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|