C31H27F2N5O5 — CID 59791950
N-[[3-fluoro-4-[7-(3-imidazol-1-ylpropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]carbamoyl]-2-(2-fluorophenyl)acetamide (PubChem CID 59791950) has the molecular formula C31H27F2N5O5 and a molecular weight of 587.58 g/mol. Its IUPAC name is N-[[3-fluoro-4-[7-(3-imidazol-1-ylpropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]carbamoyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-[7-(3-imidazol-1-ylpropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]carbamoyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 59791950 |
| Molecular Formula | C31H27F2N5O5 |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | N-[[3-fluoro-4-[7-(3-imidazol-1-ylpropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]carbamoyl]-2-(2-fluorophenyl)acetamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NC(=O)Cc4ccccc4F)cc3F)ccnc2cc1OCCCn1ccnc1 |
| InChI | InChI=1S/C31H27F2N5O5/c1-41-28-17-22-25(18-29(28)42-14-4-12-38-13-11-34-19-38)35-10-9-26(22)43-27-8-7-21(16-24(27)33)36-31(40)37-30(39)15-20-5-2-3-6-23(20)32/h2-3,5-11,13,16-19H,4,12,14-15H2,1H3,(H2,36,37,39,40) |
| InChIKey | YYITUNQBURMRLT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|