C15H12N2O3S — CID 59796910
4-methoxy-3-[(E)-2-thiophen-2-ylethenyl]-2H-indazole-5-carboxylic acid (PubChem CID 59796910) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-methoxy-3-[(E)-2-thiophen-2-ylethenyl]-2H-indazole-5-carboxylic acid.
| Compound Name | 4-methoxy-3-[(E)-2-thiophen-2-ylethenyl]-2H-indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59796910 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-methoxy-3-[(E)-2-thiophen-2-ylethenyl]-2H-indazole-5-carboxylic acid |
| SMILES | COc1c(C(=O)O)ccc2n[nH]c(/C=C/c3cccs3)c12 |
| InChI | InChI=1S/C15H12N2O3S/c1-20-14-10(15(18)19)5-7-12-13(14)11(16-17-12)6-4-9-3-2-8-21-9/h2-8H,1H3,(H,16,17)(H,18,19)/b6-4+ |
| InChIKey | FXLZQQIWOWFCOQ-GQCTYLIASA-N |
| XLogP | 3.50 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |